C22H33FN4O — CID 143896404
2-[[4-[[(E,4Z)-4-ethylidene-6-fluorohept-5-enyl]amino]piperidin-1-yl]methyl]-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one (PubChem CID 143896404) has the molecular formula C22H33FN4O and a molecular weight of 388.53 g/mol. Its IUPAC name is 2-[[4-[[(E,4Z)-4-ethylidene-6-fluorohept-5-enyl]amino]piperidin-1-yl]methyl]-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one.
| Compound Name | 2-[[4-[[(E,4Z)-4-ethylidene-6-fluorohept-5-enyl]amino]piperidin-1-yl]methyl]-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 143896404 |
| Molecular Formula | C22H33FN4O |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 2-[[4-[[(E,4Z)-4-ethylidene-6-fluorohept-5-enyl]amino]piperidin-1-yl]methyl]-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one |
| SMILES | C/C=C(\C=C(/C)F)CCCNC1CCN(CC2Cn3c(cccc3=O)N2)CC1 |
| InChI | InChI=1S/C22H33FN4O/c1-3-18(14-17(2)23)6-5-11-24-19-9-12-26(13-10-19)15-20-16-27-21(25-20)7-4-8-22(27)28/h3-4,7-8,14,19-20,24-25H,5-6,9-13,15-16H2,1-2H3/b17-14+,18-3- |
| InChIKey | NRCHJFPABSBMKX-QLFNFMNOSA-N |
| XLogP | 3.30 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|