C20H43N — CID 14389650
N,N-bis(2-methylpropyl)dodecan-1-amine (PubChem CID 14389650) has the molecular formula C20H43N and a molecular weight of 297.57 g/mol. Its IUPAC name is N,N-bis(2-methylpropyl)dodecan-1-amine.
| Compound Name | N,N-bis(2-methylpropyl)dodecan-1-amine |
|---|---|
| PubChem CID | 14389650 |
| Molecular Formula | C20H43N |
| Molecular Weight | 297.57 g/mol |
| Exact Mass | 297.34 |
| IUPAC Name | N,N-bis(2-methylpropyl)dodecan-1-amine |
| SMILES | CCCCCCCCCCCCN(CC(C)C)CC(C)C |
| InChI | InChI=1S/C20H43N/c1-6-7-8-9-10-11-12-13-14-15-16-21(17-19(2)3)18-20(4)5/h19-20H,6-18H2,1-5H3 |
| InChIKey | CXHKRLBPORFDTI-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.57 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|