C21H22N4O5 — CID 143897085
N-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]-3-(4-hydroxy-2-methanimidoylanilino)benzamide (PubChem CID 143897085) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is N-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]-3-(4-hydroxy-2-methanimidoylanilino)benzamide.
| Compound Name | N-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]-3-(4-hydroxy-2-methanimidoylanilino)benzamide |
|---|---|
| PubChem CID | 143897085 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]-3-(4-hydroxy-2-methanimidoylanilino)benzamide |
| SMILES | [H]/N=C/c1cc(O)ccc1Nc1cccc(C(=O)NCCN2C(=O)OC(C)(C)C2=O)c1 |
| InChI | InChI=1S/C21H22N4O5/c1-21(2)19(28)25(20(29)30-21)9-8-23-18(27)13-4-3-5-15(10-13)24-17-7-6-16(26)11-14(17)12-22/h3-7,10-12,22,24,26H,8-9H2,1-2H3,(H,23,27)/b22-12+ |
| InChIKey | ZUGLWYDUENKPKG-WSDLNYQXSA-N |
| XLogP | 2.62 |
| TPSA | 131.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|