C14H25F2NO — CID 143897088
2,2-difluoro-N-[(4E,6Z)-4-methylocta-4,6-dien-2-yl]propanamide;ethane (PubChem CID 143897088) has the molecular formula C14H25F2NO and a molecular weight of 261.36 g/mol. Its IUPAC name is 2,2-difluoro-N-[(4E,6Z)-4-methylocta-4,6-dien-2-yl]propanamide;ethane.
| Compound Name | 2,2-difluoro-N-[(4E,6Z)-4-methylocta-4,6-dien-2-yl]propanamide;ethane |
|---|---|
| PubChem CID | 143897088 |
| Molecular Formula | C14H25F2NO |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | 2,2-difluoro-N-[(4E,6Z)-4-methylocta-4,6-dien-2-yl]propanamide;ethane |
| SMILES | C/C=C\C=C(/C)CC(C)NC(=O)C(C)(F)F.CC |
| InChI | InChI=1S/C12H19F2NO.C2H6/c1-5-6-7-9(2)8-10(3)15-11(16)12(4,13)14;1-2/h5-7,10H,8H2,1-4H3,(H,15,16);1-2H3/b6-5-,9-7+; |
| InChIKey | DKCWTDSTANQRIP-HMERWLGPSA-N |
| XLogP | 4.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|