About 5-(3,4-dipropylphenoxy)-2-methylpyridazin-3-one;methylcyclobutane
5-(3,4-dipropylphenoxy)-2-methylpyridazin-3-one;methylcyclobutane (PubChem CID 143897180) has the molecular formula C22H32N2O2
and a molecular weight of 356.51 g/mol. Its IUPAC name is 5-(3,4-dipropylphenoxy)-2-methylpyridazin-3-one;methylcyclobutane.
Molecular Properties
| Compound Name | 5-(3,4-dipropylphenoxy)-2-methylpyridazin-3-one;methylcyclobutane |
| PubChem CID | 143897180 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 5-(3,4-dipropylphenoxy)-2-methylpyridazin-3-one;methylcyclobutane |
| SMILES | CC1CCC1.CCCc1ccc(Oc2cnn(C)c(=O)c2)cc1CCC |
| InChI | InChI=1S/C17H22N2O2.C5H10/c1-4-6-13-8-9-15(10-14(13)7-5-2)21-16-11-17(20)19(3)18-12-16;1-5-3-2-4-5/h8-12H,4-7H2,1-3H3;5H,2-4H2,1H3 |
| InChIKey | ZVTFDAJWGSWQKA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3,4-dipropylphenoxy)-2-methylpyridazin-3-one;methylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dipropylphenoxy)-2-methylpyridazin-3-one;methylcyclobutane?
The IUPAC name of 5-(3,4-dipropylphenoxy)-2-methylpyridazin-3-one;methylcyclobutane (CID 143897180) is 5-(3,4-dipropylphenoxy)-2-methylpyridazin-3-one;methylcyclobutane.
What is the SMILES notation for 5-(3,4-dipropylphenoxy)-2-methylpyridazin-3-one;methylcyclobutane?
The canonical SMILES for 5-(3,4-dipropylphenoxy)-2-methylpyridazin-3-one;methylcyclobutane is CC1CCC1.CCCc1ccc(Oc2cnn(C)c(=O)c2)cc1CCC.
What is the InChIKey of 5-(3,4-dipropylphenoxy)-2-methylpyridazin-3-one;methylcyclobutane?
The InChIKey is ZVTFDAJWGSWQKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O2.C5H10/c1-4-6-13-8-9-15(10-14(13)7-5-2)21-16-11-17(20)19(3)18-12-16;1-5-3-2-4-5/h8-12H,4-7H2,1-3H3;5H,2-4H2,1H3.
What are the key properties of 5-(3,4-dipropylphenoxy)-2-methylpyridazin-3-one;methylcyclobutane?
5-(3,4-dipropylphenoxy)-2-methylpyridazin-3-one;methylcyclobutane has a molecular weight of 356.51 g/mol, XLogP of 5.28, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dipropylphenoxy)-2-methylpyridazin-3-one;methylcyclobutane is sourced from PubChem (CID 143897180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).