C18H21F3N2O — CID 143897182
6-(3,4-dipropylphenyl)-2-(2,2,2-trifluoroethyl)pyridazin-3-one (PubChem CID 143897182) has the molecular formula C18H21F3N2O and a molecular weight of 338.37 g/mol. Its IUPAC name is 6-(3,4-dipropylphenyl)-2-(2,2,2-trifluoroethyl)pyridazin-3-one.
| Compound Name | 6-(3,4-dipropylphenyl)-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 143897182 |
| Molecular Formula | C18H21F3N2O |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 6-(3,4-dipropylphenyl)-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
| SMILES | CCCc1ccc(-c2ccc(=O)n(CC(F)(F)F)n2)cc1CCC |
| InChI | InChI=1S/C18H21F3N2O/c1-3-5-13-7-8-15(11-14(13)6-4-2)16-9-10-17(24)23(22-16)12-18(19,20)21/h7-11H,3-6,12H2,1-2H3 |
| InChIKey | MEHXQPUYBUECJO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |