About 2-(tert-butylsulfamoyl)-N-cyclohexa-1,3-dien-1-ylacetamide
2-(tert-butylsulfamoyl)-N-cyclohexa-1,3-dien-1-ylacetamide (PubChem CID 143897839) has the molecular formula C12H20N2O3S
and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-(tert-butylsulfamoyl)-N-cyclohexa-1,3-dien-1-ylacetamide.
Molecular Properties
| Compound Name | 2-(tert-butylsulfamoyl)-N-cyclohexa-1,3-dien-1-ylacetamide |
| PubChem CID | 143897839 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-(tert-butylsulfamoyl)-N-cyclohexa-1,3-dien-1-ylacetamide |
| SMILES | CC(C)(C)NS(=O)(=O)CC(=O)NC1=CC=CCC1 |
| InChI | InChI=1S/C12H20N2O3S/c1-12(2,3)14-18(16,17)9-11(15)13-10-7-5-4-6-8-10/h4-5,7,14H,6,8-9H2,1-3H3,(H,13,15) |
| InChIKey | JUPMZVUQXGTNOE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(tert-butylsulfamoyl)-N-cyclohexa-1,3-dien-1-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tert-butylsulfamoyl)-N-cyclohexa-1,3-dien-1-ylacetamide?
The IUPAC name of 2-(tert-butylsulfamoyl)-N-cyclohexa-1,3-dien-1-ylacetamide (CID 143897839) is 2-(tert-butylsulfamoyl)-N-cyclohexa-1,3-dien-1-ylacetamide.
What is the SMILES notation for 2-(tert-butylsulfamoyl)-N-cyclohexa-1,3-dien-1-ylacetamide?
The canonical SMILES for 2-(tert-butylsulfamoyl)-N-cyclohexa-1,3-dien-1-ylacetamide is CC(C)(C)NS(=O)(=O)CC(=O)NC1=CC=CCC1.
What is the InChIKey of 2-(tert-butylsulfamoyl)-N-cyclohexa-1,3-dien-1-ylacetamide?
The InChIKey is JUPMZVUQXGTNOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O3S/c1-12(2,3)14-18(16,17)9-11(15)13-10-7-5-4-6-8-10/h4-5,7,14H,6,8-9H2,1-3H3,(H,13,15).
What are the key properties of 2-(tert-butylsulfamoyl)-N-cyclohexa-1,3-dien-1-ylacetamide?
2-(tert-butylsulfamoyl)-N-cyclohexa-1,3-dien-1-ylacetamide has a molecular weight of 272.37 g/mol, XLogP of 1.05, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tert-butylsulfamoyl)-N-cyclohexa-1,3-dien-1-ylacetamide is sourced from PubChem (CID 143897839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).