C26H24Cl2N2O3S — CID 143898255
2,6-dichloro-N-[(E)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxo-5-phenylpent-3-en-2-yl]benzenesulfonamide (PubChem CID 143898255) has the molecular formula C26H24Cl2N2O3S and a molecular weight of 515.46 g/mol. Its IUPAC name is 2,6-dichloro-N-[(E)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxo-5-phenylpent-3-en-2-yl]benzenesulfonamide.
| Compound Name | 2,6-dichloro-N-[(E)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxo-5-phenylpent-3-en-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 143898255 |
| Molecular Formula | C26H24Cl2N2O3S |
| Molecular Weight | 515.46 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | 2,6-dichloro-N-[(E)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxo-5-phenylpent-3-en-2-yl]benzenesulfonamide |
| SMILES | O=C(C(/C=C/Cc1ccccc1)NS(=O)(=O)c1c(Cl)cccc1Cl)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C26H24Cl2N2O3S/c27-22-13-7-14-23(28)25(22)34(32,33)29-24(15-6-10-19-8-2-1-3-9-19)26(31)30-17-16-20-11-4-5-12-21(20)18-30/h1-9,11-15,24,29H,10,16-18H2/b15-6+ |
| InChIKey | RJBRXBGKGYJQIP-GIDUJCDVSA-N |
| XLogP | 5.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|