About 3,7-difluoro-2H-azepine
3,7-difluoro-2H-azepine (PubChem CID 143898404) has the molecular formula C6H5F2N
and a molecular weight of 129.11 g/mol. Its IUPAC name is 3,7-difluoro-2H-azepine.
Molecular Properties
| Compound Name | 3,7-difluoro-2H-azepine |
| PubChem CID | 143898404 |
| Molecular Formula | C6H5F2N |
| Molecular Weight | 129.11 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | 3,7-difluoro-2H-azepine |
| SMILES | FC1=CC=CC(F)=NC1 |
| InChI | InChI=1S/C6H5F2N/c7-5-2-1-3-6(8)9-4-5/h1-3H,4H2 |
| InChIKey | XDLAXJFASPVURJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.11 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,7-difluoro-2H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-difluoro-2H-azepine?
The IUPAC name of 3,7-difluoro-2H-azepine (CID 143898404) is 3,7-difluoro-2H-azepine.
What is the SMILES notation for 3,7-difluoro-2H-azepine?
The canonical SMILES for 3,7-difluoro-2H-azepine is FC1=CC=CC(F)=NC1.
What is the InChIKey of 3,7-difluoro-2H-azepine?
The InChIKey is XDLAXJFASPVURJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F2N/c7-5-2-1-3-6(8)9-4-5/h1-3H,4H2.
What are the key properties of 3,7-difluoro-2H-azepine?
3,7-difluoro-2H-azepine has a molecular weight of 129.11 g/mol, XLogP of 1.78, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-difluoro-2H-azepine is sourced from PubChem (CID 143898404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).