About ethane;4-N-ethenyl-5-ethyl-4-N-phosphanylpyrimidine-2,4-diamine
ethane;4-N-ethenyl-5-ethyl-4-N-phosphanylpyrimidine-2,4-diamine (PubChem CID 143898517) has the molecular formula C12H25N4P
and a molecular weight of 256.33 g/mol. Its IUPAC name is ethane;4-N-ethenyl-5-ethyl-4-N-phosphanylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | ethane;4-N-ethenyl-5-ethyl-4-N-phosphanylpyrimidine-2,4-diamine |
| PubChem CID | 143898517 |
| Molecular Formula | C12H25N4P |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | ethane;4-N-ethenyl-5-ethyl-4-N-phosphanylpyrimidine-2,4-diamine |
| SMILES | C=CN(P)c1nc(N)ncc1CC.CC.CC |
| InChI | InChI=1S/C8H13N4P.2C2H6/c1-3-6-5-10-8(9)11-7(6)12(13)4-2;2*1-2/h4-5H,2-3,13H2,1H3,(H2,9,10,11);2*1-2H3 |
| InChIKey | KLCHJRKIFGHMAN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-N-ethenyl-5-ethyl-4-N-phosphanylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-N-ethenyl-5-ethyl-4-N-phosphanylpyrimidine-2,4-diamine?
The IUPAC name of ethane;4-N-ethenyl-5-ethyl-4-N-phosphanylpyrimidine-2,4-diamine (CID 143898517) is ethane;4-N-ethenyl-5-ethyl-4-N-phosphanylpyrimidine-2,4-diamine.
What is the SMILES notation for ethane;4-N-ethenyl-5-ethyl-4-N-phosphanylpyrimidine-2,4-diamine?
The canonical SMILES for ethane;4-N-ethenyl-5-ethyl-4-N-phosphanylpyrimidine-2,4-diamine is C=CN(P)c1nc(N)ncc1CC.CC.CC.
What is the InChIKey of ethane;4-N-ethenyl-5-ethyl-4-N-phosphanylpyrimidine-2,4-diamine?
The InChIKey is KLCHJRKIFGHMAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N4P.2C2H6/c1-3-6-5-10-8(9)11-7(6)12(13)4-2;2*1-2/h4-5H,2-3,13H2,1H3,(H2,9,10,11);2*1-2H3.
What are the key properties of ethane;4-N-ethenyl-5-ethyl-4-N-phosphanylpyrimidine-2,4-diamine?
ethane;4-N-ethenyl-5-ethyl-4-N-phosphanylpyrimidine-2,4-diamine has a molecular weight of 256.33 g/mol, XLogP of 3.41, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-N-ethenyl-5-ethyl-4-N-phosphanylpyrimidine-2,4-diamine is sourced from PubChem (CID 143898517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).