About 2-ethylsulfanyl-1-methyl-5,6-dihydrobenzimidazole
2-ethylsulfanyl-1-methyl-5,6-dihydrobenzimidazole (PubChem CID 143899621) has the molecular formula C10H14N2S
and a molecular weight of 194.30 g/mol. Its IUPAC name is 2-ethylsulfanyl-1-methyl-5,6-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 2-ethylsulfanyl-1-methyl-5,6-dihydrobenzimidazole |
| PubChem CID | 143899621 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-ethylsulfanyl-1-methyl-5,6-dihydrobenzimidazole |
| SMILES | CCSc1nc2c(n1C)=CCCC=2 |
| InChI | InChI=1S/C10H14N2S/c1-3-13-10-11-8-6-4-5-7-9(8)12(10)2/h6-7H,3-5H2,1-2H3 |
| InChIKey | GRAZXSPIGLGFQI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethylsulfanyl-1-methyl-5,6-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanyl-1-methyl-5,6-dihydrobenzimidazole?
The IUPAC name of 2-ethylsulfanyl-1-methyl-5,6-dihydrobenzimidazole (CID 143899621) is 2-ethylsulfanyl-1-methyl-5,6-dihydrobenzimidazole.
What is the SMILES notation for 2-ethylsulfanyl-1-methyl-5,6-dihydrobenzimidazole?
The canonical SMILES for 2-ethylsulfanyl-1-methyl-5,6-dihydrobenzimidazole is CCSc1nc2c(n1C)=CCCC=2.
What is the InChIKey of 2-ethylsulfanyl-1-methyl-5,6-dihydrobenzimidazole?
The InChIKey is GRAZXSPIGLGFQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2S/c1-3-13-10-11-8-6-4-5-7-9(8)12(10)2/h6-7H,3-5H2,1-2H3.
What are the key properties of 2-ethylsulfanyl-1-methyl-5,6-dihydrobenzimidazole?
2-ethylsulfanyl-1-methyl-5,6-dihydrobenzimidazole has a molecular weight of 194.30 g/mol, XLogP of 0.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanyl-1-methyl-5,6-dihydrobenzimidazole is sourced from PubChem (CID 143899621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).