C21H26N4O2 — CID 143899778
4-[4,6-bis(3,6-dihydro-2H-pyran-4-yl)-1,3,5-triazin-2-yl]aniline;ethane (PubChem CID 143899778) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 4-[4,6-bis(3,6-dihydro-2H-pyran-4-yl)-1,3,5-triazin-2-yl]aniline;ethane.
| Compound Name | 4-[4,6-bis(3,6-dihydro-2H-pyran-4-yl)-1,3,5-triazin-2-yl]aniline;ethane |
|---|---|
| PubChem CID | 143899778 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 4-[4,6-bis(3,6-dihydro-2H-pyran-4-yl)-1,3,5-triazin-2-yl]aniline;ethane |
| SMILES | CC.Nc1ccc(-c2nc(C3=CCOCC3)nc(C3=CCOCC3)n2)cc1 |
| InChI | InChI=1S/C19H20N4O2.C2H6/c20-16-3-1-13(2-4-16)17-21-18(14-5-9-24-10-6-14)23-19(22-17)15-7-11-25-12-8-15;1-2/h1-5,7H,6,8-12,20H2;1-2H3 |
| InChIKey | FQNZZMWDICTTHT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|