About 1-tert-butyl-4-methylpiperazine;1-(1-ethylpiperidin-4-yl)-N,N-dimethylmethanamine;propane
1-tert-butyl-4-methylpiperazine;1-(1-ethylpiperidin-4-yl)-N,N-dimethylmethanamine;propane (PubChem CID 143900023) has the molecular formula C22H50N4
and a molecular weight of 370.67 g/mol. Its IUPAC name is 1-tert-butyl-4-methylpiperazine;1-(1-ethylpiperidin-4-yl)-N,N-dimethylmethanamine;propane.
Molecular Properties
| Compound Name | 1-tert-butyl-4-methylpiperazine;1-(1-ethylpiperidin-4-yl)-N,N-dimethylmethanamine;propane |
| PubChem CID | 143900023 |
| Molecular Formula | C22H50N4 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 370.40 |
| IUPAC Name | 1-tert-butyl-4-methylpiperazine;1-(1-ethylpiperidin-4-yl)-N,N-dimethylmethanamine;propane |
| SMILES | CCC.CCN1CCC(CN(C)C)CC1.CN1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C10H22N2.C9H20N2.C3H8/c1-4-12-7-5-10(6-8-12)9-11(2)3;1-9(2,3)11-7-5-10(4)6-8-11;1-3-2/h10H,4-9H2,1-3H3;5-8H2,1-4H3;3H2,1-2H3 |
| InChIKey | AJYGJUWRJWAUTM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-tert-butyl-4-methylpiperazine;1-(1-ethylpiperidin-4-yl)-N,N-dimethylmethanamine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-methylpiperazine;1-(1-ethylpiperidin-4-yl)-N,N-dimethylmethanamine;propane?
The IUPAC name of 1-tert-butyl-4-methylpiperazine;1-(1-ethylpiperidin-4-yl)-N,N-dimethylmethanamine;propane (CID 143900023) is 1-tert-butyl-4-methylpiperazine;1-(1-ethylpiperidin-4-yl)-N,N-dimethylmethanamine;propane.
What is the SMILES notation for 1-tert-butyl-4-methylpiperazine;1-(1-ethylpiperidin-4-yl)-N,N-dimethylmethanamine;propane?
The canonical SMILES for 1-tert-butyl-4-methylpiperazine;1-(1-ethylpiperidin-4-yl)-N,N-dimethylmethanamine;propane is CCC.CCN1CCC(CN(C)C)CC1.CN1CCN(C(C)(C)C)CC1.
What is the InChIKey of 1-tert-butyl-4-methylpiperazine;1-(1-ethylpiperidin-4-yl)-N,N-dimethylmethanamine;propane?
The InChIKey is AJYGJUWRJWAUTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2.C9H20N2.C3H8/c1-4-12-7-5-10(6-8-12)9-11(2)3;1-9(2,3)11-7-5-10(4)6-8-11;1-3-2/h10H,4-9H2,1-3H3;5-8H2,1-4H3;3H2,1-2H3.
What are the key properties of 1-tert-butyl-4-methylpiperazine;1-(1-ethylpiperidin-4-yl)-N,N-dimethylmethanamine;propane?
1-tert-butyl-4-methylpiperazine;1-(1-ethylpiperidin-4-yl)-N,N-dimethylmethanamine;propane has a molecular weight of 370.67 g/mol, XLogP of 3.73, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-methylpiperazine;1-(1-ethylpiperidin-4-yl)-N,N-dimethylmethanamine;propane is sourced from PubChem (CID 143900023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).