C19H29N3OS — CID 143900231
ethane;[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-piperazin-1-ylmethanone (PubChem CID 143900231) has the molecular formula C19H29N3OS and a molecular weight of 347.53 g/mol. Its IUPAC name is ethane;[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-piperazin-1-ylmethanone.
| Compound Name | ethane;[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 143900231 |
| Molecular Formula | C19H29N3OS |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | ethane;[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-piperazin-1-ylmethanone |
| SMILES | CC.CC.Cc1nc(-c2cccc(C(=O)N3CCNCC3)c2)cs1 |
| InChI | InChI=1S/C15H17N3OS.2C2H6/c1-11-17-14(10-20-11)12-3-2-4-13(9-12)15(19)18-7-5-16-6-8-18;2*1-2/h2-4,9-10,16H,5-8H2,1H3;2*1-2H3 |
| InChIKey | KGRYSPINHHRXOX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |