About propane;3,4,6-trimethylpyridazine
propane;3,4,6-trimethylpyridazine (PubChem CID 143900357) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is propane;3,4,6-trimethylpyridazine.
Molecular Properties
| Compound Name | propane;3,4,6-trimethylpyridazine |
| PubChem CID | 143900357 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | propane;3,4,6-trimethylpyridazine |
| SMILES | CCC.Cc1cc(C)c(C)nn1 |
| InChI | InChI=1S/C7H10N2.C3H8/c1-5-4-6(2)8-9-7(5)3;1-3-2/h4H,1-3H3;3H2,1-2H3 |
| InChIKey | RYAZBJMBQRUEHR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propane;3,4,6-trimethylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;3,4,6-trimethylpyridazine?
The IUPAC name of propane;3,4,6-trimethylpyridazine (CID 143900357) is propane;3,4,6-trimethylpyridazine.
What is the SMILES notation for propane;3,4,6-trimethylpyridazine?
The canonical SMILES for propane;3,4,6-trimethylpyridazine is CCC.Cc1cc(C)c(C)nn1.
What is the InChIKey of propane;3,4,6-trimethylpyridazine?
The InChIKey is RYAZBJMBQRUEHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C3H8/c1-5-4-6(2)8-9-7(5)3;1-3-2/h4H,1-3H3;3H2,1-2H3.
What are the key properties of propane;3,4,6-trimethylpyridazine?
propane;3,4,6-trimethylpyridazine has a molecular weight of 166.27 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propane;3,4,6-trimethylpyridazine is sourced from PubChem (CID 143900357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).