About 1-bromo-3-ethoxybenzene;ethane
1-bromo-3-ethoxybenzene;ethane (PubChem CID 143900364) has the molecular formula C10H15BrO
and a molecular weight of 231.13 g/mol. Its IUPAC name is 1-bromo-3-ethoxybenzene;ethane.
Molecular Properties
| Compound Name | 1-bromo-3-ethoxybenzene;ethane |
| PubChem CID | 143900364 |
| Molecular Formula | C10H15BrO |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 1-bromo-3-ethoxybenzene;ethane |
| SMILES | CC.CCOc1cccc(Br)c1 |
| InChI | InChI=1S/C8H9BrO.C2H6/c1-2-10-8-5-3-4-7(9)6-8;1-2/h3-6H,2H2,1H3;1-2H3 |
| InChIKey | POPQINDCABINIC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-3-ethoxybenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-ethoxybenzene;ethane?
The IUPAC name of 1-bromo-3-ethoxybenzene;ethane (CID 143900364) is 1-bromo-3-ethoxybenzene;ethane.
What is the SMILES notation for 1-bromo-3-ethoxybenzene;ethane?
The canonical SMILES for 1-bromo-3-ethoxybenzene;ethane is CC.CCOc1cccc(Br)c1.
What is the InChIKey of 1-bromo-3-ethoxybenzene;ethane?
The InChIKey is POPQINDCABINIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrO.C2H6/c1-2-10-8-5-3-4-7(9)6-8;1-2/h3-6H,2H2,1H3;1-2H3.
What are the key properties of 1-bromo-3-ethoxybenzene;ethane?
1-bromo-3-ethoxybenzene;ethane has a molecular weight of 231.13 g/mol, XLogP of 3.87, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-ethoxybenzene;ethane is sourced from PubChem (CID 143900364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).