C31H51FO2 — CID 143901361
8-[4-[(2E,4Z)-2-fluoro-4-(4-pentylcyclohexyl)hexa-2,4-dienyl]cyclohexyl]-1,4-dioxaspiro[4.5]decane (PubChem CID 143901361) has the molecular formula C31H51FO2 and a molecular weight of 474.75 g/mol. Its IUPAC name is 8-[4-[(2E,4Z)-2-fluoro-4-(4-pentylcyclohexyl)hexa-2,4-dienyl]cyclohexyl]-1,4-dioxaspiro[4.5]decane.
| Compound Name | 8-[4-[(2E,4Z)-2-fluoro-4-(4-pentylcyclohexyl)hexa-2,4-dienyl]cyclohexyl]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 143901361 |
| Molecular Formula | C31H51FO2 |
| Molecular Weight | 474.75 g/mol |
| Exact Mass | 474.39 |
| IUPAC Name | 8-[4-[(2E,4Z)-2-fluoro-4-(4-pentylcyclohexyl)hexa-2,4-dienyl]cyclohexyl]-1,4-dioxaspiro[4.5]decane |
| SMILES | C/C=C(\C=C(\F)CC1CCC(C2CCC3(CC2)OCCO3)CC1)C1CCC(CCCCC)CC1 |
| InChI | InChI=1S/C31H51FO2/c1-3-5-6-7-24-8-12-27(13-9-24)26(4-2)23-30(32)22-25-10-14-28(15-11-25)29-16-18-31(19-17-29)33-20-21-34-31/h4,23-25,27-29H,3,5-22H2,1-2H3/b26-4+,30-23+ |
| InChIKey | KJYBCACFQARPTG-VJCNDFSPSA-N |
| XLogP | 9.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.75 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|