C17H18N4O2S — CID 143901518
methylcyclopropane;N-[5-(5-methyl-1,2,4-oxadiazol-3-yl)-4-phenyl-1,3-thiazol-2-yl]formamide (PubChem CID 143901518) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is methylcyclopropane;N-[5-(5-methyl-1,2,4-oxadiazol-3-yl)-4-phenyl-1,3-thiazol-2-yl]formamide.
| Compound Name | methylcyclopropane;N-[5-(5-methyl-1,2,4-oxadiazol-3-yl)-4-phenyl-1,3-thiazol-2-yl]formamide |
|---|---|
| PubChem CID | 143901518 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | methylcyclopropane;N-[5-(5-methyl-1,2,4-oxadiazol-3-yl)-4-phenyl-1,3-thiazol-2-yl]formamide |
| SMILES | CC1CC1.Cc1nc(-c2sc(NC=O)nc2-c2ccccc2)no1 |
| InChI | InChI=1S/C13H10N4O2S.C4H8/c1-8-15-12(17-19-8)11-10(9-5-3-2-4-6-9)16-13(20-11)14-7-18;1-4-2-3-4/h2-7H,1H3,(H,14,16,18);4H,2-3H2,1H3 |
| InChIKey | JXWZXHMAFFUKGH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|