About 6-methyl-2,3-dihydro-1,4-benzodioxine;1-methylnaphthalene
6-methyl-2,3-dihydro-1,4-benzodioxine;1-methylnaphthalene (PubChem CID 143901590) has the molecular formula C20H20O2
and a molecular weight of 292.38 g/mol. Its IUPAC name is 6-methyl-2,3-dihydro-1,4-benzodioxine;1-methylnaphthalene.
Molecular Properties
| Compound Name | 6-methyl-2,3-dihydro-1,4-benzodioxine;1-methylnaphthalene |
| PubChem CID | 143901590 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 6-methyl-2,3-dihydro-1,4-benzodioxine;1-methylnaphthalene |
| SMILES | Cc1ccc2c(c1)OCCO2.Cc1cccc2ccccc12 |
| InChI | InChI=1S/C11H10.C9H10O2/c1-9-5-4-7-10-6-2-3-8-11(9)10;1-7-2-3-8-9(6-7)11-5-4-10-8/h2-8H,1H3;2-3,6H,4-5H2,1H3 |
| InChIKey | FZHQWHBWIJKNRF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-2,3-dihydro-1,4-benzodioxine;1-methylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,3-dihydro-1,4-benzodioxine;1-methylnaphthalene?
The IUPAC name of 6-methyl-2,3-dihydro-1,4-benzodioxine;1-methylnaphthalene (CID 143901590) is 6-methyl-2,3-dihydro-1,4-benzodioxine;1-methylnaphthalene.
What is the SMILES notation for 6-methyl-2,3-dihydro-1,4-benzodioxine;1-methylnaphthalene?
The canonical SMILES for 6-methyl-2,3-dihydro-1,4-benzodioxine;1-methylnaphthalene is Cc1ccc2c(c1)OCCO2.Cc1cccc2ccccc12.
What is the InChIKey of 6-methyl-2,3-dihydro-1,4-benzodioxine;1-methylnaphthalene?
The InChIKey is FZHQWHBWIJKNRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10.C9H10O2/c1-9-5-4-7-10-6-2-3-8-11(9)10;1-7-2-3-8-9(6-7)11-5-4-10-8/h2-8H,1H3;2-3,6H,4-5H2,1H3.
What are the key properties of 6-methyl-2,3-dihydro-1,4-benzodioxine;1-methylnaphthalene?
6-methyl-2,3-dihydro-1,4-benzodioxine;1-methylnaphthalene has a molecular weight of 292.38 g/mol, XLogP of 4.91, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,3-dihydro-1,4-benzodioxine;1-methylnaphthalene is sourced from PubChem (CID 143901590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).