C10H12N2O2 — CID 143901939
5-cyano-6-methylpyridine-2-carboxylic acid;ethane (PubChem CID 143901939) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 5-cyano-6-methylpyridine-2-carboxylic acid;ethane.
| Compound Name | 5-cyano-6-methylpyridine-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 143901939 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 5-cyano-6-methylpyridine-2-carboxylic acid;ethane |
| SMILES | CC.Cc1nc(C(=O)O)ccc1C#N |
| InChI | InChI=1S/C8H6N2O2.C2H6/c1-5-6(4-9)2-3-7(10-5)8(11)12;1-2/h2-3H,1H3,(H,11,12);1-2H3 |
| InChIKey | SFTCUYGULMIWOR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |