C12H19NO — CID 143902089
ethane;6-methyl-3,4,7,8-tetrahydro-1H-quinolin-2-one (PubChem CID 143902089) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is ethane;6-methyl-3,4,7,8-tetrahydro-1H-quinolin-2-one.
| Compound Name | ethane;6-methyl-3,4,7,8-tetrahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 143902089 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | ethane;6-methyl-3,4,7,8-tetrahydro-1H-quinolin-2-one |
| SMILES | CC.CC1=CC2=C(CC1)NC(=O)CC2 |
| InChI | InChI=1S/C10H13NO.C2H6/c1-7-2-4-9-8(6-7)3-5-10(12)11-9;1-2/h6H,2-5H2,1H3,(H,11,12);1-2H3 |
| InChIKey | QHJVCXSVGKAULI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |