About ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrolizine
ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrolizine (PubChem CID 143902101) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrolizine.
Molecular Properties
| Compound Name | ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrolizine |
| PubChem CID | 143902101 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrolizine |
| SMILES | C=Cc1cc2n(c1/C=C\C)CCC2.CC |
| InChI | InChI=1S/C12H15N.C2H6/c1-3-6-12-10(4-2)9-11-7-5-8-13(11)12;1-2/h3-4,6,9H,2,5,7-8H2,1H3;1-2H3/b6-3-; |
| InChIKey | KVFNYSQFNASHSQ-AQPBACSKSA-N |
| XLogP | 4.14 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrolizine?
The IUPAC name of ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrolizine (CID 143902101) is ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrolizine.
What is the SMILES notation for ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrolizine?
The canonical SMILES for ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrolizine is C=Cc1cc2n(c1/C=C\C)CCC2.CC.
What is the InChIKey of ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrolizine?
The InChIKey is KVFNYSQFNASHSQ-AQPBACSKSA-N. The full InChI is InChI=1S/C12H15N.C2H6/c1-3-6-12-10(4-2)9-11-7-5-8-13(11)12;1-2/h3-4,6,9H,2,5,7-8H2,1H3;1-2H3/b6-3-;.
What are the key properties of ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrolizine?
ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrolizine has a molecular weight of 203.33 g/mol, XLogP of 4.14, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-ethenyl-5-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrolizine is sourced from PubChem (CID 143902101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).