C8H12N2 — CID 143902113
6-methyl-2,3,4,5-tetrahydro-1H-indazole (PubChem CID 143902113) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 6-methyl-2,3,4,5-tetrahydro-1H-indazole.
| Compound Name | 6-methyl-2,3,4,5-tetrahydro-1H-indazole |
|---|---|
| PubChem CID | 143902113 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 6-methyl-2,3,4,5-tetrahydro-1H-indazole |
| SMILES | CC1=CC2=C(CC1)CNN2 |
| InChI | InChI=1S/C8H12N2/c1-6-2-3-7-5-9-10-8(7)4-6/h4,9-10H,2-3,5H2,1H3 |
| InChIKey | OLTKDFVYCOMZOE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |