About 4-[1-(2-hexyl-2-methyl-1,3-dioxolan-4-yl)propoxy]-4-methylheptanal;methanol
4-[1-(2-hexyl-2-methyl-1,3-dioxolan-4-yl)propoxy]-4-methylheptanal;methanol (PubChem CID 143902446) has the molecular formula C23H48O6
and a molecular weight of 420.63 g/mol. Its IUPAC name is 4-[1-(2-hexyl-2-methyl-1,3-dioxolan-4-yl)propoxy]-4-methylheptanal;methanol.
Molecular Properties
| Compound Name | 4-[1-(2-hexyl-2-methyl-1,3-dioxolan-4-yl)propoxy]-4-methylheptanal;methanol |
| PubChem CID | 143902446 |
| Molecular Formula | C23H48O6 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.35 |
| IUPAC Name | 4-[1-(2-hexyl-2-methyl-1,3-dioxolan-4-yl)propoxy]-4-methylheptanal;methanol |
| SMILES | CCCCCCC1(C)OCC(C(CC)OC(C)(CCC)CCC=O)O1.CO.CO |
| InChI | InChI=1S/C21H40O4.2CH4O/c1-6-9-10-11-15-21(5)23-17-19(25-21)18(8-3)24-20(4,13-7-2)14-12-16-22;2*1-2/h16,18-19H,6-15,17H2,1-5H3;2*2H,1H3 |
| InChIKey | GEXJMSKLYAYMNM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(2-hexyl-2-methyl-1,3-dioxolan-4-yl)propoxy]-4-methylheptanal;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(2-hexyl-2-methyl-1,3-dioxolan-4-yl)propoxy]-4-methylheptanal;methanol?
The IUPAC name of 4-[1-(2-hexyl-2-methyl-1,3-dioxolan-4-yl)propoxy]-4-methylheptanal;methanol (CID 143902446) is 4-[1-(2-hexyl-2-methyl-1,3-dioxolan-4-yl)propoxy]-4-methylheptanal;methanol.
What is the SMILES notation for 4-[1-(2-hexyl-2-methyl-1,3-dioxolan-4-yl)propoxy]-4-methylheptanal;methanol?
The canonical SMILES for 4-[1-(2-hexyl-2-methyl-1,3-dioxolan-4-yl)propoxy]-4-methylheptanal;methanol is CCCCCCC1(C)OCC(C(CC)OC(C)(CCC)CCC=O)O1.CO.CO.
What is the InChIKey of 4-[1-(2-hexyl-2-methyl-1,3-dioxolan-4-yl)propoxy]-4-methylheptanal;methanol?
The InChIKey is GEXJMSKLYAYMNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O4.2CH4O/c1-6-9-10-11-15-21(5)23-17-19(25-21)18(8-3)24-20(4,13-7-2)14-12-16-22;2*1-2/h16,18-19H,6-15,17H2,1-5H3;2*2H,1H3.
What are the key properties of 4-[1-(2-hexyl-2-methyl-1,3-dioxolan-4-yl)propoxy]-4-methylheptanal;methanol?
4-[1-(2-hexyl-2-methyl-1,3-dioxolan-4-yl)propoxy]-4-methylheptanal;methanol has a molecular weight of 420.63 g/mol, XLogP of 4.64, 14 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(2-hexyl-2-methyl-1,3-dioxolan-4-yl)propoxy]-4-methylheptanal;methanol is sourced from PubChem (CID 143902446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).