C26H28N4O2 — CID 143902920
N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2-[3-(morpholin-4-ylmethyl)phenyl]imidazo[1,2-a]pyridine-8-carboxamide (PubChem CID 143902920) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2-[3-(morpholin-4-ylmethyl)phenyl]imidazo[1,2-a]pyridine-8-carboxamide.
| Compound Name | N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2-[3-(morpholin-4-ylmethyl)phenyl]imidazo[1,2-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 143902920 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2-[3-(morpholin-4-ylmethyl)phenyl]imidazo[1,2-a]pyridine-8-carboxamide |
| SMILES | C=C/C=C\C=C(/C)NC(=O)c1cccn2cc(-c3cccc(CN4CCOCC4)c3)nc12 |
| InChI | InChI=1S/C26H28N4O2/c1-3-4-5-8-20(2)27-26(31)23-11-7-12-30-19-24(28-25(23)30)22-10-6-9-21(17-22)18-29-13-15-32-16-14-29/h3-12,17,19H,1,13-16,18H2,2H3,(H,27,31)/b5-4-,20-8+ |
| InChIKey | KSXZHBQMCGFIMY-HRIIHXOXSA-N |
| XLogP | 4.21 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|