About (3E)-3-(difluoromethyl)-5-methoxy-2-methylidenehexa-3,5-dienal
(3E)-3-(difluoromethyl)-5-methoxy-2-methylidenehexa-3,5-dienal (PubChem CID 143902962) has the molecular formula C9H10F2O2
and a molecular weight of 188.17 g/mol. Its IUPAC name is (3E)-3-(difluoromethyl)-5-methoxy-2-methylidenehexa-3,5-dienal.
Molecular Properties
| Compound Name | (3E)-3-(difluoromethyl)-5-methoxy-2-methylidenehexa-3,5-dienal |
| PubChem CID | 143902962 |
| Molecular Formula | C9H10F2O2 |
| Molecular Weight | 188.17 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | (3E)-3-(difluoromethyl)-5-methoxy-2-methylidenehexa-3,5-dienal |
| SMILES | C=C(/C=C(\C(=C)C=O)C(F)F)OC |
| InChI | InChI=1S/C9H10F2O2/c1-6(5-12)8(9(10)11)4-7(2)13-3/h4-5,9H,1-2H2,3H3/b8-4+ |
| InChIKey | UFJSOFXFJRERDZ-XBXARRHUSA-N |
| XLogP | 2.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.17 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-(difluoromethyl)-5-methoxy-2-methylidenehexa-3,5-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(difluoromethyl)-5-methoxy-2-methylidenehexa-3,5-dienal?
The IUPAC name of (3E)-3-(difluoromethyl)-5-methoxy-2-methylidenehexa-3,5-dienal (CID 143902962) is (3E)-3-(difluoromethyl)-5-methoxy-2-methylidenehexa-3,5-dienal.
What is the SMILES notation for (3E)-3-(difluoromethyl)-5-methoxy-2-methylidenehexa-3,5-dienal?
The canonical SMILES for (3E)-3-(difluoromethyl)-5-methoxy-2-methylidenehexa-3,5-dienal is C=C(/C=C(\C(=C)C=O)C(F)F)OC.
What is the InChIKey of (3E)-3-(difluoromethyl)-5-methoxy-2-methylidenehexa-3,5-dienal?
The InChIKey is UFJSOFXFJRERDZ-XBXARRHUSA-N. The full InChI is InChI=1S/C9H10F2O2/c1-6(5-12)8(9(10)11)4-7(2)13-3/h4-5,9H,1-2H2,3H3/b8-4+.
What are the key properties of (3E)-3-(difluoromethyl)-5-methoxy-2-methylidenehexa-3,5-dienal?
(3E)-3-(difluoromethyl)-5-methoxy-2-methylidenehexa-3,5-dienal has a molecular weight of 188.17 g/mol, XLogP of 2.09, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(difluoromethyl)-5-methoxy-2-methylidenehexa-3,5-dienal is sourced from PubChem (CID 143902962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).