About (2S)-2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylpropanamide
(2S)-2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylpropanamide (PubChem CID 14390407) has the molecular formula C17H17ClN4O
and a molecular weight of 328.80 g/mol. Its IUPAC name is (2S)-2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | (2S)-2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylpropanamide |
| PubChem CID | 14390407 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (2S)-2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylpropanamide |
| SMILES | C[C@@H](C(=O)N(C)C)n1c(-c2ccc(Cl)cc2)nc2cccnc21 |
| InChI | InChI=1S/C17H17ClN4O/c1-11(17(23)21(2)3)22-15(12-6-8-13(18)9-7-12)20-14-5-4-10-19-16(14)22/h4-11H,1-3H3/t11-/m0/s1 |
| InChIKey | METKHKQSAQCIIF-NSHDSACASA-N |
| XLogP | 3.40 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylpropanamide?
The IUPAC name of (2S)-2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylpropanamide (CID 14390407) is (2S)-2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylpropanamide.
What is the SMILES notation for (2S)-2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylpropanamide?
The canonical SMILES for (2S)-2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylpropanamide is C[C@@H](C(=O)N(C)C)n1c(-c2ccc(Cl)cc2)nc2cccnc21.
What is the InChIKey of (2S)-2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylpropanamide?
The InChIKey is METKHKQSAQCIIF-NSHDSACASA-N. The full InChI is InChI=1S/C17H17ClN4O/c1-11(17(23)21(2)3)22-15(12-6-8-13(18)9-7-12)20-14-5-4-10-19-16(14)22/h4-11H,1-3H3/t11-/m0/s1.
What are the key properties of (2S)-2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylpropanamide?
(2S)-2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylpropanamide has a molecular weight of 328.80 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-N,N-dimethylpropanamide is sourced from PubChem (CID 14390407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).