About 3,4-dihydroxybenzaldehyde;heptane
3,4-dihydroxybenzaldehyde;heptane (PubChem CID 143904261) has the molecular formula C14H22O3
and a molecular weight of 238.33 g/mol. Its IUPAC name is 3,4-dihydroxybenzaldehyde;heptane.
Molecular Properties
| Compound Name | 3,4-dihydroxybenzaldehyde;heptane |
| PubChem CID | 143904261 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 3,4-dihydroxybenzaldehyde;heptane |
| SMILES | CCCCCCC.O=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C7H6O3.C7H16/c8-4-5-1-2-6(9)7(10)3-5;1-3-5-7-6-4-2/h1-4,9-10H;3-7H2,1-2H3 |
| InChIKey | MLLZSYJVNDKHPA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydroxybenzaldehyde;heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydroxybenzaldehyde;heptane?
The IUPAC name of 3,4-dihydroxybenzaldehyde;heptane (CID 143904261) is 3,4-dihydroxybenzaldehyde;heptane.
What is the SMILES notation for 3,4-dihydroxybenzaldehyde;heptane?
The canonical SMILES for 3,4-dihydroxybenzaldehyde;heptane is CCCCCCC.O=Cc1ccc(O)c(O)c1.
What is the InChIKey of 3,4-dihydroxybenzaldehyde;heptane?
The InChIKey is MLLZSYJVNDKHPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.C7H16/c8-4-5-1-2-6(9)7(10)3-5;1-3-5-7-6-4-2/h1-4,9-10H;3-7H2,1-2H3.
What are the key properties of 3,4-dihydroxybenzaldehyde;heptane?
3,4-dihydroxybenzaldehyde;heptane has a molecular weight of 238.33 g/mol, XLogP of 3.89, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroxybenzaldehyde;heptane is sourced from PubChem (CID 143904261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).