C18H25NO — CID 143904354
2-amino-1,1-diphenylethanol;2-methylpropane (PubChem CID 143904354) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 2-amino-1,1-diphenylethanol;2-methylpropane.
| Compound Name | 2-amino-1,1-diphenylethanol;2-methylpropane |
|---|---|
| PubChem CID | 143904354 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 2-amino-1,1-diphenylethanol;2-methylpropane |
| SMILES | CC(C)C.NCC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H15NO.C4H10/c15-11-14(16,12-7-3-1-4-8-12)13-9-5-2-6-10-13;1-4(2)3/h1-10,16H,11,15H2;4H,1-3H3 |
| InChIKey | ZYXFJZJGCWSJEX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |