C27H38N2O2S — CID 143905211
3-[4-[[3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]-2-hydroxypropyl]-methylamino]sulfanyl-2-methylphenyl]propanal (PubChem CID 143905211) has the molecular formula C27H38N2O2S and a molecular weight of 454.68 g/mol. Its IUPAC name is 3-[4-[[3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]-2-hydroxypropyl]-methylamino]sulfanyl-2-methylphenyl]propanal.
| Compound Name | 3-[4-[[3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]-2-hydroxypropyl]-methylamino]sulfanyl-2-methylphenyl]propanal |
|---|---|
| PubChem CID | 143905211 |
| Molecular Formula | C27H38N2O2S |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 3-[4-[[3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]-2-hydroxypropyl]-methylamino]sulfanyl-2-methylphenyl]propanal |
| SMILES | Cc1cc(SN(C)CC(O)CNC(C)(C)CC2Cc3ccccc3C2)ccc1CCC=O |
| InChI | InChI=1S/C27H38N2O2S/c1-20-14-26(12-11-22(20)10-7-13-30)32-29(4)19-25(31)18-28-27(2,3)17-21-15-23-8-5-6-9-24(23)16-21/h5-6,8-9,11-14,21,25,28,31H,7,10,15-19H2,1-4H3 |
| InChIKey | DVOYBYLHCSAAFO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|