C15H23NO — CID 143906545
1-cyclohepta-1,3,4,6-tetraen-1-ylpyrrolidin-2-one;ethane (PubChem CID 143906545) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 1-cyclohepta-1,3,4,6-tetraen-1-ylpyrrolidin-2-one;ethane.
| Compound Name | 1-cyclohepta-1,3,4,6-tetraen-1-ylpyrrolidin-2-one;ethane |
|---|---|
| PubChem CID | 143906545 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 1-cyclohepta-1,3,4,6-tetraen-1-ylpyrrolidin-2-one;ethane |
| SMILES | CC.CC.O=C1CCCN1C1=CC=C=CC=C1 |
| InChI | InChI=1S/C11H11NO.2C2H6/c13-11-8-5-9-12(11)10-6-3-1-2-4-7-10;2*1-2/h1,3-4,6-7H,5,8-9H2;2*1-2H3 |
| InChIKey | XUJZIQZZCRXQQQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |