C11H11NO — CID 143906546
1-cyclohepta-1,3,4,6-tetraen-1-ylpyrrolidin-2-one (PubChem CID 143906546) has the molecular formula C11H11NO and a molecular weight of 173.22 g/mol. Its IUPAC name is 1-cyclohepta-1,3,4,6-tetraen-1-ylpyrrolidin-2-one.
| Compound Name | 1-cyclohepta-1,3,4,6-tetraen-1-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 143906546 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 1-cyclohepta-1,3,4,6-tetraen-1-ylpyrrolidin-2-one |
| SMILES | O=C1CCCN1C1=CC=C=CC=C1 |
| InChI | InChI=1S/C11H11NO/c13-11-8-5-9-12(11)10-6-3-1-2-4-7-10/h1,3-4,6-7H,5,8-9H2 |
| InChIKey | XIHASQSBVGQEMW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |