C33H25F3N8O2 — CID 143906565
N-[3-cyano-3-hydroxy-1-[(3E,5E)-6-(9-phenyl-3-pyrimidin-2-yl-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl)hepta-1,3,5-trien-3-yl]cyclobutyl]-2,2,2-trifluoroacetamide (PubChem CID 143906565) has the molecular formula C33H25F3N8O2 and a molecular weight of 622.61 g/mol. Its IUPAC name is N-[3-cyano-3-hydroxy-1-[(3E,5E)-6-(9-phenyl-3-pyrimidin-2-yl-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl)hepta-1,3,5-trien-3-yl]cyclobutyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-cyano-3-hydroxy-1-[(3E,5E)-6-(9-phenyl-3-pyrimidin-2-yl-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl)hepta-1,3,5-trien-3-yl]cyclobutyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 143906565 |
| Molecular Formula | C33H25F3N8O2 |
| Molecular Weight | 622.61 g/mol |
| Exact Mass | 622.21 |
| IUPAC Name | N-[3-cyano-3-hydroxy-1-[(3E,5E)-6-(9-phenyl-3-pyrimidin-2-yl-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl)hepta-1,3,5-trien-3-yl]cyclobutyl]-2,2,2-trifluoroacetamide |
| SMILES | C=C/C(=C\C=C(/C)c1nc2ccn3c(-c4ncccn4)nnc3c2cc1-c1ccccc1)C1(NC(=O)C(F)(F)F)CC(O)(C#N)C1 |
| InChI | InChI=1S/C33H25F3N8O2/c1-3-22(32(17-31(46,18-32)19-37)41-30(45)33(34,35)36)11-10-20(2)26-23(21-8-5-4-6-9-21)16-24-25(40-26)12-15-44-28(24)42-43-29(44)27-38-13-7-14-39-27/h3-16,46H,1,17-18H2,2H3,(H,41,45)/b20-10+,22-11+ |
| InChIKey | LLYXCMNFMIUMEM-PSMOSDAISA-N |
| XLogP | 5.38 |
| TPSA | 141.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|