C20H18N5O4S2+ — CID 143906897
[3-[[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]sulfamoyl]-4-methylphenyl]-methyl-oxoazanium (PubChem CID 143906897) has the molecular formula C20H18N5O4S2+ and a molecular weight of 456.53 g/mol. Its IUPAC name is [3-[[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]sulfamoyl]-4-methylphenyl]-methyl-oxoazanium.
| Compound Name | [3-[[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]sulfamoyl]-4-methylphenyl]-methyl-oxoazanium |
|---|---|
| PubChem CID | 143906897 |
| Molecular Formula | C20H18N5O4S2+ |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | [3-[[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]sulfamoyl]-4-methylphenyl]-methyl-oxoazanium |
| SMILES | Cc1ccc([N+](C)=O)cc1S(=O)(=O)Nc1cc(Sc2ncn[nH]2)c(O)c2ccccc12 |
| InChI | InChI=1S/C20H17N5O4S2/c1-12-7-8-13(25(2)27)9-18(12)31(28,29)24-16-10-17(30-20-21-11-22-23-20)19(26)15-6-4-3-5-14(15)16/h3-11,24H,1-2H3,(H-,21,22,23,26)/p+1 |
| InChIKey | KDNIQDPWCKITFZ-UHFFFAOYSA-O |
| XLogP | 3.96 |
| TPSA | 128.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|