About ethane;(Z)-1-N-hexyl-1-N-(methylideneamino)hex-1-ene-1,2-diamine
ethane;(Z)-1-N-hexyl-1-N-(methylideneamino)hex-1-ene-1,2-diamine (PubChem CID 143906997) has the molecular formula C21H51N3
and a molecular weight of 345.66 g/mol. Its IUPAC name is ethane;(Z)-1-N-hexyl-1-N-(methylideneamino)hex-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | ethane;(Z)-1-N-hexyl-1-N-(methylideneamino)hex-1-ene-1,2-diamine |
| PubChem CID | 143906997 |
| Molecular Formula | C21H51N3 |
| Molecular Weight | 345.66 g/mol |
| Exact Mass | 345.41 |
| IUPAC Name | ethane;(Z)-1-N-hexyl-1-N-(methylideneamino)hex-1-ene-1,2-diamine |
| SMILES | C=NN(/C=C(\N)CCCC)CCCCCC.CC.CC.CC.CC |
| InChI | InChI=1S/C13H27N3.4C2H6/c1-4-6-8-9-11-16(15-3)12-13(14)10-7-5-2;4*1-2/h12H,3-11,14H2,1-2H3;4*1-2H3/b13-12-;;;; |
| InChIKey | UWPNDPFZCDEHQJ-XXXTXXBHSA-N |
| XLogP | 7.58 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.66 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-1-N-hexyl-1-N-(methylideneamino)hex-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-1-N-hexyl-1-N-(methylideneamino)hex-1-ene-1,2-diamine?
The IUPAC name of ethane;(Z)-1-N-hexyl-1-N-(methylideneamino)hex-1-ene-1,2-diamine (CID 143906997) is ethane;(Z)-1-N-hexyl-1-N-(methylideneamino)hex-1-ene-1,2-diamine.
What is the SMILES notation for ethane;(Z)-1-N-hexyl-1-N-(methylideneamino)hex-1-ene-1,2-diamine?
The canonical SMILES for ethane;(Z)-1-N-hexyl-1-N-(methylideneamino)hex-1-ene-1,2-diamine is C=NN(/C=C(\N)CCCC)CCCCCC.CC.CC.CC.CC.
What is the InChIKey of ethane;(Z)-1-N-hexyl-1-N-(methylideneamino)hex-1-ene-1,2-diamine?
The InChIKey is UWPNDPFZCDEHQJ-XXXTXXBHSA-N. The full InChI is InChI=1S/C13H27N3.4C2H6/c1-4-6-8-9-11-16(15-3)12-13(14)10-7-5-2;4*1-2/h12H,3-11,14H2,1-2H3;4*1-2H3/b13-12-;;;;.
What are the key properties of ethane;(Z)-1-N-hexyl-1-N-(methylideneamino)hex-1-ene-1,2-diamine?
ethane;(Z)-1-N-hexyl-1-N-(methylideneamino)hex-1-ene-1,2-diamine has a molecular weight of 345.66 g/mol, XLogP of 7.58, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-1-N-hexyl-1-N-(methylideneamino)hex-1-ene-1,2-diamine is sourced from PubChem (CID 143906997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).