About ethane;5-hexyl-3-propyl-1,2-dihydrotriazole
ethane;5-hexyl-3-propyl-1,2-dihydrotriazole (PubChem CID 143907003) has the molecular formula C15H35N3
and a molecular weight of 257.47 g/mol. Its IUPAC name is ethane;5-hexyl-3-propyl-1,2-dihydrotriazole.
Molecular Properties
| Compound Name | ethane;5-hexyl-3-propyl-1,2-dihydrotriazole |
| PubChem CID | 143907003 |
| Molecular Formula | C15H35N3 |
| Molecular Weight | 257.47 g/mol |
| Exact Mass | 257.28 |
| IUPAC Name | ethane;5-hexyl-3-propyl-1,2-dihydrotriazole |
| SMILES | CC.CC.CCCCCCC1=CN(CCC)NN1 |
| InChI | InChI=1S/C11H23N3.2C2H6/c1-3-5-6-7-8-11-10-14(9-4-2)13-12-11;2*1-2/h10,12-13H,3-9H2,1-2H3;2*1-2H3 |
| InChIKey | MZVKOYOMFYUMCR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-hexyl-3-propyl-1,2-dihydrotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-hexyl-3-propyl-1,2-dihydrotriazole?
The IUPAC name of ethane;5-hexyl-3-propyl-1,2-dihydrotriazole (CID 143907003) is ethane;5-hexyl-3-propyl-1,2-dihydrotriazole.
What is the SMILES notation for ethane;5-hexyl-3-propyl-1,2-dihydrotriazole?
The canonical SMILES for ethane;5-hexyl-3-propyl-1,2-dihydrotriazole is CC.CC.CCCCCCC1=CN(CCC)NN1.
What is the InChIKey of ethane;5-hexyl-3-propyl-1,2-dihydrotriazole?
The InChIKey is MZVKOYOMFYUMCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3.2C2H6/c1-3-5-6-7-8-11-10-14(9-4-2)13-12-11;2*1-2/h10,12-13H,3-9H2,1-2H3;2*1-2H3.
What are the key properties of ethane;5-hexyl-3-propyl-1,2-dihydrotriazole?
ethane;5-hexyl-3-propyl-1,2-dihydrotriazole has a molecular weight of 257.47 g/mol, XLogP of 4.59, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-hexyl-3-propyl-1,2-dihydrotriazole is sourced from PubChem (CID 143907003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).