C12H13BrO — CID 143907200
(3E,5E)-1-bromo-3-[(1E)-buta-1,3-dienyl]octa-3,5,7-trien-2-one (PubChem CID 143907200) has the molecular formula C12H13BrO and a molecular weight of 253.14 g/mol. Its IUPAC name is (3E,5E)-1-bromo-3-[(1E)-buta-1,3-dienyl]octa-3,5,7-trien-2-one.
| Compound Name | (3E,5E)-1-bromo-3-[(1E)-buta-1,3-dienyl]octa-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 143907200 |
| Molecular Formula | C12H13BrO |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | (3E,5E)-1-bromo-3-[(1E)-buta-1,3-dienyl]octa-3,5,7-trien-2-one |
| SMILES | C=C/C=C/C=C(\C=C\C=C)C(=O)CBr |
| InChI | InChI=1S/C12H13BrO/c1-3-5-7-9-11(8-6-4-2)12(14)10-13/h3-9H,1-2,10H2/b7-5+,8-6+,11-9+ |
| InChIKey | DOIZNVVKXYWQHU-NDNIUKBNSA-N |
| XLogP | 3.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|