C43H78N4 — CID 143907224
(8S,16E)-8,23,37,37-tetramethyl-26-propan-2-yl-5,12,21,28-tetrazahexacyclo[26.2.2.22,5.27,10.212,15.218,21]tetracont-16-ene (PubChem CID 143907224) has the molecular formula C43H78N4 and a molecular weight of 651.13 g/mol. Its IUPAC name is (8S,16E)-8,23,37,37-tetramethyl-26-propan-2-yl-5,12,21,28-tetrazahexacyclo[26.2.2.22,5.27,10.212,15.218,21]tetracont-16-ene.
| Compound Name | (8S,16E)-8,23,37,37-tetramethyl-26-propan-2-yl-5,12,21,28-tetrazahexacyclo[26.2.2.22,5.27,10.212,15.218,21]tetracont-16-ene |
|---|---|
| PubChem CID | 143907224 |
| Molecular Formula | C43H78N4 |
| Molecular Weight | 651.13 g/mol |
| Exact Mass | 650.62 |
| IUPAC Name | (8S,16E)-8,23,37,37-tetramethyl-26-propan-2-yl-5,12,21,28-tetrazahexacyclo[26.2.2.22,5.27,10.212,15.218,21]tetracont-16-ene |
| SMILES | CC1CCC(C(C)C)CN2CCC(CC2)C2CCN(CC2)CC2CC(C)(C)C(C[C@@H]2C)CN2CCC(/C=C/C3CCN(CC3)C1)CC2 |
| InChI | InChI=1S/C43H78N4/c1-33(2)40-10-7-34(3)29-44-19-11-36(12-20-44)8-9-37-13-21-47(22-14-37)32-42-27-35(4)41(28-43(42,5)6)31-46-25-17-39(18-26-46)38-15-23-45(30-40)24-16-38/h8-9,33-42H,7,10-32H2,1-6H3/b9-8+/t34?,35-,40?,41?,42?/m0/s1 |
| InChIKey | XOWRGBOSWAOHFU-HFAXOAFASA-N |
| XLogP | 8.78 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.13 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|