About [(E)-7-(1,4-dioxaspiro[4.4]nonan-8-yl)-4-methyl-6-oxooct-4-en-2-yl] acetate
[(E)-7-(1,4-dioxaspiro[4.4]nonan-8-yl)-4-methyl-6-oxooct-4-en-2-yl] acetate (PubChem CID 143907239) has the molecular formula C18H28O5
and a molecular weight of 324.42 g/mol. Its IUPAC name is [(E)-7-(1,4-dioxaspiro[4.4]nonan-8-yl)-4-methyl-6-oxooct-4-en-2-yl] acetate.
Molecular Properties
| Compound Name | [(E)-7-(1,4-dioxaspiro[4.4]nonan-8-yl)-4-methyl-6-oxooct-4-en-2-yl] acetate |
| PubChem CID | 143907239 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | [(E)-7-(1,4-dioxaspiro[4.4]nonan-8-yl)-4-methyl-6-oxooct-4-en-2-yl] acetate |
| SMILES | CC(=O)OC(C)C/C(C)=C/C(=O)C(C)C1CCC2(C1)OCCO2 |
| InChI | InChI=1S/C18H28O5/c1-12(9-13(2)23-15(4)19)10-17(20)14(3)16-5-6-18(11-16)21-7-8-22-18/h10,13-14,16H,5-9,11H2,1-4H3/b12-10+ |
| InChIKey | OJXZTNRVJKFEQF-ZRDIBKRKSA-N |
| XLogP | 3.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(E)-7-(1,4-dioxaspiro[4.4]nonan-8-yl)-4-methyl-6-oxooct-4-en-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-7-(1,4-dioxaspiro[4.4]nonan-8-yl)-4-methyl-6-oxooct-4-en-2-yl] acetate?
The IUPAC name of [(E)-7-(1,4-dioxaspiro[4.4]nonan-8-yl)-4-methyl-6-oxooct-4-en-2-yl] acetate (CID 143907239) is [(E)-7-(1,4-dioxaspiro[4.4]nonan-8-yl)-4-methyl-6-oxooct-4-en-2-yl] acetate.
What is the SMILES notation for [(E)-7-(1,4-dioxaspiro[4.4]nonan-8-yl)-4-methyl-6-oxooct-4-en-2-yl] acetate?
The canonical SMILES for [(E)-7-(1,4-dioxaspiro[4.4]nonan-8-yl)-4-methyl-6-oxooct-4-en-2-yl] acetate is CC(=O)OC(C)C/C(C)=C/C(=O)C(C)C1CCC2(C1)OCCO2.
What is the InChIKey of [(E)-7-(1,4-dioxaspiro[4.4]nonan-8-yl)-4-methyl-6-oxooct-4-en-2-yl] acetate?
The InChIKey is OJXZTNRVJKFEQF-ZRDIBKRKSA-N. The full InChI is InChI=1S/C18H28O5/c1-12(9-13(2)23-15(4)19)10-17(20)14(3)16-5-6-18(11-16)21-7-8-22-18/h10,13-14,16H,5-9,11H2,1-4H3/b12-10+.
What are the key properties of [(E)-7-(1,4-dioxaspiro[4.4]nonan-8-yl)-4-methyl-6-oxooct-4-en-2-yl] acetate?
[(E)-7-(1,4-dioxaspiro[4.4]nonan-8-yl)-4-methyl-6-oxooct-4-en-2-yl] acetate has a molecular weight of 324.42 g/mol, XLogP of 3.02, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-7-(1,4-dioxaspiro[4.4]nonan-8-yl)-4-methyl-6-oxooct-4-en-2-yl] acetate is sourced from PubChem (CID 143907239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).