About methoxymethane;1-methylazepan-4-one
methoxymethane;1-methylazepan-4-one (PubChem CID 143907303) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is methoxymethane;1-methylazepan-4-one.
Molecular Properties
| Compound Name | methoxymethane;1-methylazepan-4-one |
| PubChem CID | 143907303 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | methoxymethane;1-methylazepan-4-one |
| SMILES | CN1CCCC(=O)CC1.COC |
| InChI | InChI=1S/C7H13NO.C2H6O/c1-8-5-2-3-7(9)4-6-8;1-3-2/h2-6H2,1H3;1-2H3 |
| InChIKey | XTECVXFYRCXTIY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methoxymethane;1-methylazepan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;1-methylazepan-4-one?
The IUPAC name of methoxymethane;1-methylazepan-4-one (CID 143907303) is methoxymethane;1-methylazepan-4-one.
What is the SMILES notation for methoxymethane;1-methylazepan-4-one?
The canonical SMILES for methoxymethane;1-methylazepan-4-one is CN1CCCC(=O)CC1.COC.
What is the InChIKey of methoxymethane;1-methylazepan-4-one?
The InChIKey is XTECVXFYRCXTIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C2H6O/c1-8-5-2-3-7(9)4-6-8;1-3-2/h2-6H2,1H3;1-2H3.
What are the key properties of methoxymethane;1-methylazepan-4-one?
methoxymethane;1-methylazepan-4-one has a molecular weight of 173.26 g/mol, XLogP of 0.93, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;1-methylazepan-4-one is sourced from PubChem (CID 143907303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).