C19H19FN4 — CID 143908288
ethane;12-fluoro-8,13-dimethyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 143908288) has the molecular formula C19H19FN4 and a molecular weight of 322.39 g/mol. Its IUPAC name is ethane;12-fluoro-8,13-dimethyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | ethane;12-fluoro-8,13-dimethyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 143908288 |
| Molecular Formula | C19H19FN4 |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | ethane;12-fluoro-8,13-dimethyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | CC.Cc1c(F)cnc2c1c1cc(-c3cccnc3)ncc1n2C |
| InChI | InChI=1S/C17H13FN4.C2H6/c1-10-13(18)8-21-17-16(10)12-6-14(11-4-3-5-19-7-11)20-9-15(12)22(17)2;1-2/h3-9H,1-2H3;1-2H3 |
| InChIKey | BPPPFGDXRDITQR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |