C15H22F2O2 — CID 143908826
(7Z)-9-ethoxy-7,8-difluoro-2,5-dimethyl-6-methylidenedeca-7,9-dienal (PubChem CID 143908826) has the molecular formula C15H22F2O2 and a molecular weight of 272.33 g/mol. Its IUPAC name is (7Z)-9-ethoxy-7,8-difluoro-2,5-dimethyl-6-methylidenedeca-7,9-dienal.
| Compound Name | (7Z)-9-ethoxy-7,8-difluoro-2,5-dimethyl-6-methylidenedeca-7,9-dienal |
|---|---|
| PubChem CID | 143908826 |
| Molecular Formula | C15H22F2O2 |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (7Z)-9-ethoxy-7,8-difluoro-2,5-dimethyl-6-methylidenedeca-7,9-dienal |
| SMILES | C=C(OCC)/C(F)=C(/F)C(=C)C(C)CCC(C)C=O |
| InChI | InChI=1S/C15H22F2O2/c1-6-19-13(5)15(17)14(16)12(4)11(3)8-7-10(2)9-18/h9-11H,4-8H2,1-3H3/b15-14- |
| InChIKey | HUJKFYDZPVSCJN-PFONDFGASA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|