C16H20F2O — CID 143908884
(3Z,7Z)-2-butoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraene (PubChem CID 143908884) has the molecular formula C16H20F2O and a molecular weight of 266.33 g/mol. Its IUPAC name is (3Z,7Z)-2-butoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraene.
| Compound Name | (3Z,7Z)-2-butoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 143908884 |
| Molecular Formula | C16H20F2O |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (3Z,7Z)-2-butoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraene |
| SMILES | C=C/C(F)=C(/F)C(=C)C(=C)/C=C\C(=C)OCCCC |
| InChI | InChI=1S/C16H20F2O/c1-6-8-11-19-13(4)10-9-12(3)14(5)16(18)15(17)7-2/h7,9-10H,2-6,8,11H2,1H3/b10-9-,16-15- |
| InChIKey | XAUNWSVZDZURFK-GJWNNSPJSA-N |
| XLogP | 5.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|