About ethane;3-pyridin-4-yl-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole
ethane;3-pyridin-4-yl-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole (PubChem CID 143910207) has the molecular formula C21H28N4O
and a molecular weight of 352.48 g/mol. Its IUPAC name is ethane;3-pyridin-4-yl-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | ethane;3-pyridin-4-yl-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole |
| PubChem CID | 143910207 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | ethane;3-pyridin-4-yl-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole |
| SMILES | CC.CC.c1cc(-c2noc(-c3ccc(N4CCCC4)cc3)n2)ccn1 |
| InChI | InChI=1S/C17H16N4O.2C2H6/c1-2-12-21(11-1)15-5-3-14(4-6-15)17-19-16(20-22-17)13-7-9-18-10-8-13;2*1-2/h3-10H,1-2,11-12H2;2*1-2H3 |
| InChIKey | BUYMCSAPRLUKOO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;3-pyridin-4-yl-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-pyridin-4-yl-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole?
The IUPAC name of ethane;3-pyridin-4-yl-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole (CID 143910207) is ethane;3-pyridin-4-yl-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole.
What is the SMILES notation for ethane;3-pyridin-4-yl-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole?
The canonical SMILES for ethane;3-pyridin-4-yl-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole is CC.CC.c1cc(-c2noc(-c3ccc(N4CCCC4)cc3)n2)ccn1.
What is the InChIKey of ethane;3-pyridin-4-yl-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole?
The InChIKey is BUYMCSAPRLUKOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O.2C2H6/c1-2-12-21(11-1)15-5-3-14(4-6-15)17-19-16(20-22-17)13-7-9-18-10-8-13;2*1-2/h3-10H,1-2,11-12H2;2*1-2H3.
What are the key properties of ethane;3-pyridin-4-yl-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole?
ethane;3-pyridin-4-yl-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole has a molecular weight of 352.48 g/mol, XLogP of 5.45, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-pyridin-4-yl-5-(4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole is sourced from PubChem (CID 143910207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).