C22H28N4O3 — CID 143910298
1-[4-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-N'-ethyl-N-methylmethanediamine (PubChem CID 143910298) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-[4-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-N'-ethyl-N-methylmethanediamine.
| Compound Name | 1-[4-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-N'-ethyl-N-methylmethanediamine |
|---|---|
| PubChem CID | 143910298 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-[4-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-N'-ethyl-N-methylmethanediamine |
| SMILES | CCNC(NC)c1ccc(-c2noc(-c3ccc(OCC)c(OCC)c3)n2)cc1 |
| InChI | InChI=1S/C22H28N4O3/c1-5-24-20(23-4)15-8-10-16(11-9-15)21-25-22(29-26-21)17-12-13-18(27-6-2)19(14-17)28-7-3/h8-14,20,23-24H,5-7H2,1-4H3 |
| InChIKey | VVNOEABQJKQFMC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 81.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|