C22H29F3N2 — CID 143910762
(2Z,6E,8Z)-4,5-dimethylidene-6-(trifluoromethyl)deca-2,6,8-trien-1-imine;(3Z,5Z)-2-methylideneocta-3,5-dien-1-amine (PubChem CID 143910762) has the molecular formula C22H29F3N2 and a molecular weight of 378.48 g/mol. Its IUPAC name is (2Z,6E,8Z)-4,5-dimethylidene-6-(trifluoromethyl)deca-2,6,8-trien-1-imine;(3Z,5Z)-2-methylideneocta-3,5-dien-1-amine.
| Compound Name | (2Z,6E,8Z)-4,5-dimethylidene-6-(trifluoromethyl)deca-2,6,8-trien-1-imine;(3Z,5Z)-2-methylideneocta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 143910762 |
| Molecular Formula | C22H29F3N2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (2Z,6E,8Z)-4,5-dimethylidene-6-(trifluoromethyl)deca-2,6,8-trien-1-imine;(3Z,5Z)-2-methylideneocta-3,5-dien-1-amine |
| SMILES | C=C(/C=C\C=C/CC)CN.[H]/N=C/C=C\C(=C)C(=C)/C(=C\C=C/C)C(F)(F)F |
| InChI | InChI=1S/C13H14F3N.C9H15N/c1-4-5-8-12(13(14,15)16)11(3)10(2)7-6-9-17;1-3-4-5-6-7-9(2)8-10/h4-9,17H,2-3H2,1H3;4-7H,2-3,8,10H2,1H3/b5-4-,7-6-,12-8+,17-9+;5-4-,7-6- |
| InChIKey | UGBHDKBZVIHGMQ-GTOBMWBMSA-N |
| XLogP | 6.39 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|