C13H14F3N — CID 143910763
(2Z,6E,8Z)-4,5-dimethylidene-6-(trifluoromethyl)deca-2,6,8-trien-1-imine (PubChem CID 143910763) has the molecular formula C13H14F3N and a molecular weight of 241.26 g/mol. Its IUPAC name is (2Z,6E,8Z)-4,5-dimethylidene-6-(trifluoromethyl)deca-2,6,8-trien-1-imine.
| Compound Name | (2Z,6E,8Z)-4,5-dimethylidene-6-(trifluoromethyl)deca-2,6,8-trien-1-imine |
|---|---|
| PubChem CID | 143910763 |
| Molecular Formula | C13H14F3N |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (2Z,6E,8Z)-4,5-dimethylidene-6-(trifluoromethyl)deca-2,6,8-trien-1-imine |
| SMILES | [H]/N=C/C=C\C(=C)C(=C)/C(=C\C=C/C)C(F)(F)F |
| InChI | InChI=1S/C13H14F3N/c1-4-5-8-12(13(14,15)16)11(3)10(2)7-6-9-17/h4-9,17H,2-3H2,1H3/b5-4-,7-6-,12-8+,17-9+ |
| InChIKey | IYEFWCGMMZCSST-UEVHOPASSA-N |
| XLogP | 4.37 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|