About N-(4-ethoxybutan-2-yl)-1,2-dimethylpyridin-2-amine
N-(4-ethoxybutan-2-yl)-1,2-dimethylpyridin-2-amine (PubChem CID 143910777) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is N-(4-ethoxybutan-2-yl)-1,2-dimethylpyridin-2-amine.
Molecular Properties
| Compound Name | N-(4-ethoxybutan-2-yl)-1,2-dimethylpyridin-2-amine |
| PubChem CID | 143910777 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | N-(4-ethoxybutan-2-yl)-1,2-dimethylpyridin-2-amine |
| SMILES | CCOCCC(C)NC1(C)C=CC=CN1C |
| InChI | InChI=1S/C13H24N2O/c1-5-16-11-8-12(2)14-13(3)9-6-7-10-15(13)4/h6-7,9-10,12,14H,5,8,11H2,1-4H3 |
| InChIKey | MUXGUONFCVTNGA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4-ethoxybutan-2-yl)-1,2-dimethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-ethoxybutan-2-yl)-1,2-dimethylpyridin-2-amine?
The IUPAC name of N-(4-ethoxybutan-2-yl)-1,2-dimethylpyridin-2-amine (CID 143910777) is N-(4-ethoxybutan-2-yl)-1,2-dimethylpyridin-2-amine.
What is the SMILES notation for N-(4-ethoxybutan-2-yl)-1,2-dimethylpyridin-2-amine?
The canonical SMILES for N-(4-ethoxybutan-2-yl)-1,2-dimethylpyridin-2-amine is CCOCCC(C)NC1(C)C=CC=CN1C.
What is the InChIKey of N-(4-ethoxybutan-2-yl)-1,2-dimethylpyridin-2-amine?
The InChIKey is MUXGUONFCVTNGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O/c1-5-16-11-8-12(2)14-13(3)9-6-7-10-15(13)4/h6-7,9-10,12,14H,5,8,11H2,1-4H3.
What are the key properties of N-(4-ethoxybutan-2-yl)-1,2-dimethylpyridin-2-amine?
N-(4-ethoxybutan-2-yl)-1,2-dimethylpyridin-2-amine has a molecular weight of 224.35 g/mol, XLogP of 2.12, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-ethoxybutan-2-yl)-1,2-dimethylpyridin-2-amine is sourced from PubChem (CID 143910777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).