C16H23F3N2 — CID 143910840
(6Z,8Z)-6-ethenyl-1-N',1-N'-dimethyl-5-methylidene-7-(trifluoromethyl)deca-2,6,8-triene-1,1-diamine (PubChem CID 143910840) has the molecular formula C16H23F3N2 and a molecular weight of 300.37 g/mol. Its IUPAC name is (6Z,8Z)-6-ethenyl-1-N',1-N'-dimethyl-5-methylidene-7-(trifluoromethyl)deca-2,6,8-triene-1,1-diamine.
| Compound Name | (6Z,8Z)-6-ethenyl-1-N',1-N'-dimethyl-5-methylidene-7-(trifluoromethyl)deca-2,6,8-triene-1,1-diamine |
|---|---|
| PubChem CID | 143910840 |
| Molecular Formula | C16H23F3N2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (6Z,8Z)-6-ethenyl-1-N',1-N'-dimethyl-5-methylidene-7-(trifluoromethyl)deca-2,6,8-triene-1,1-diamine |
| SMILES | C=C/C(C(=C)CC=CC(N)N(C)C)=C(\C=C/C)C(F)(F)F |
| InChI | InChI=1S/C16H23F3N2/c1-6-9-14(16(17,18)19)13(7-2)12(3)10-8-11-15(20)21(4)5/h6-9,11,15H,2-3,10,20H2,1,4-5H3/b9-6-,11-8?,14-13- |
| InChIKey | BDJGKPYYCYYABY-DLHRUKPVSA-N |
| XLogP | 3.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|