About 6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline;hydrofluoride
6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline;hydrofluoride (PubChem CID 143910994) has the molecular formula C13H17F2N
and a molecular weight of 225.28 g/mol. Its IUPAC name is 6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline;hydrofluoride.
Molecular Properties
| Compound Name | 6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline;hydrofluoride |
| PubChem CID | 143910994 |
| Molecular Formula | C13H17F2N |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline;hydrofluoride |
| SMILES | CCC1C=c2ccc(C(C)F)nc2=CC1.F |
| InChI | InChI=1S/C13H16FN.FH/c1-3-10-4-6-13-11(8-10)5-7-12(15-13)9(2)14;/h5-10H,3-4H2,1-2H3;1H |
| InChIKey | NGTXNIMRSZXQAW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline;hydrofluoride?
The IUPAC name of 6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline;hydrofluoride (CID 143910994) is 6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline;hydrofluoride.
What is the SMILES notation for 6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline;hydrofluoride?
The canonical SMILES for 6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline;hydrofluoride is CCC1C=c2ccc(C(C)F)nc2=CC1.F.
What is the InChIKey of 6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline;hydrofluoride?
The InChIKey is NGTXNIMRSZXQAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FN.FH/c1-3-10-4-6-13-11(8-10)5-7-12(15-13)9(2)14;/h5-10H,3-4H2,1-2H3;1H.
What are the key properties of 6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline;hydrofluoride?
6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline;hydrofluoride has a molecular weight of 225.28 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline;hydrofluoride is sourced from PubChem (CID 143910994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).